C11H12Cl2N2O4 — CID 106891196
3-(2,6-dichloro-4-nitroanilino)pentanoic acid (PubChem CID 106891196) has the molecular formula C11H12Cl2N2O4 and a molecular weight of 307.13 g/mol. Its IUPAC name is 3-(2,6-dichloro-4-nitroanilino)pentanoic acid.
| Compound Name | 3-(2,6-dichloro-4-nitroanilino)pentanoic acid |
|---|---|
| PubChem CID | 106891196 |
| Molecular Formula | C11H12Cl2N2O4 |
| Molecular Weight | 307.13 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 3-(2,6-dichloro-4-nitroanilino)pentanoic acid |
| SMILES | CCC(CC(=O)O)Nc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C11H12Cl2N2O4/c1-2-6(3-10(16)17)14-11-8(12)4-7(15(18)19)5-9(11)13/h4-6,14H,2-3H2,1H3,(H,16,17) |
| InChIKey | PGDACWANHDSWDA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.13 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|