C20H13N5O7S — CID 4673556
3-cyano-N-(4-methoxy-2-nitrophenyl)-3-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-2-oxopropanamide (PubChem CID 4673556) has the molecular formula C20H13N5O7S and a molecular weight of 467.42 g/mol. Its IUPAC name is 3-cyano-N-(4-methoxy-2-nitrophenyl)-3-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-2-oxopropanamide.
| Compound Name | 3-cyano-N-(4-methoxy-2-nitrophenyl)-3-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-2-oxopropanamide |
|---|---|
| PubChem CID | 4673556 |
| Molecular Formula | C20H13N5O7S |
| Molecular Weight | 467.42 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 3-cyano-N-(4-methoxy-2-nitrophenyl)-3-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-2-oxopropanamide |
| SMILES | COc1ccc(NC(=O)C(=O)C(C#N)c2nc(-c3ccc([N+](=O)[O-])cc3)cs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H13N5O7S/c1-32-13-6-7-15(17(8-13)25(30)31)22-19(27)18(26)14(9-21)20-23-16(10-33-20)11-2-4-12(5-3-11)24(28)29/h2-8,10,14H,1H3,(H,22,27) |
| InChIKey | RFFLIPPCWUANLL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 178.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|