C17H18N2O2S — CID 94815121
(2S)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-oxoheptanenitrile (PubChem CID 94815121) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is (2S)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-oxoheptanenitrile.
| Compound Name | (2S)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-oxoheptanenitrile |
|---|---|
| PubChem CID | 94815121 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (2S)-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-oxoheptanenitrile |
| SMILES | CCCCC(=O)[C@H](C#N)c1nc(-c2ccc(OC)cc2)cs1 |
| InChI | InChI=1S/C17H18N2O2S/c1-3-4-5-16(20)14(10-18)17-19-15(11-22-17)12-6-8-13(21-2)9-7-12/h6-9,11,14H,3-5H2,1-2H3/t14-/m0/s1 |
| InChIKey | MPYAOJPHFRESHY-AWEZNQCLSA-N |
| XLogP | 4.19 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |