C21H18N2O2S — CID 23965686
4-(4-ethylphenoxy)-3-oxo-2-(4-phenyl-1,3-thiazol-2-yl)butanenitrile (PubChem CID 23965686) has the molecular formula C21H18N2O2S and a molecular weight of 362.45 g/mol. Its IUPAC name is 4-(4-ethylphenoxy)-3-oxo-2-(4-phenyl-1,3-thiazol-2-yl)butanenitrile.
| Compound Name | 4-(4-ethylphenoxy)-3-oxo-2-(4-phenyl-1,3-thiazol-2-yl)butanenitrile |
|---|---|
| PubChem CID | 23965686 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 4-(4-ethylphenoxy)-3-oxo-2-(4-phenyl-1,3-thiazol-2-yl)butanenitrile |
| SMILES | CCc1ccc(OCC(=O)C(C#N)c2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C21H18N2O2S/c1-2-15-8-10-17(11-9-15)25-13-20(24)18(12-22)21-23-19(14-26-21)16-6-4-3-5-7-16/h3-11,14,18H,2,13H2,1H3 |
| InChIKey | GKKXZPZXYRWNRP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |