C19H13N3O4S — CID 23822844
2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-3-oxo-4-phenoxybutanenitrile (PubChem CID 23822844) has the molecular formula C19H13N3O4S and a molecular weight of 379.40 g/mol. Its IUPAC name is 2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-3-oxo-4-phenoxybutanenitrile.
| Compound Name | 2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-3-oxo-4-phenoxybutanenitrile |
|---|---|
| PubChem CID | 23822844 |
| Molecular Formula | C19H13N3O4S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 2-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-3-oxo-4-phenoxybutanenitrile |
| SMILES | N#CC(C(=O)COc1ccccc1)c1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C19H13N3O4S/c20-10-16(18(23)11-26-15-7-2-1-3-8-15)19-21-17(12-27-19)13-5-4-6-14(9-13)22(24)25/h1-9,12,16H,11H2 |
| InChIKey | CCDDRKHBBKEGDJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 106.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|