C19H18N2O2S — CID 94814714
(2R)-4-[(1S)-cyclopent-2-en-1-yl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-oxobutanenitrile (PubChem CID 94814714) has the molecular formula C19H18N2O2S and a molecular weight of 338.43 g/mol. Its IUPAC name is (2R)-4-[(1S)-cyclopent-2-en-1-yl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-oxobutanenitrile.
| Compound Name | (2R)-4-[(1S)-cyclopent-2-en-1-yl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-oxobutanenitrile |
|---|---|
| PubChem CID | 94814714 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | (2R)-4-[(1S)-cyclopent-2-en-1-yl]-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-oxobutanenitrile |
| SMILES | COc1ccc(-c2csc([C@H](C#N)C(=O)C[C@H]3C=CCC3)n2)cc1 |
| InChI | InChI=1S/C19H18N2O2S/c1-23-15-8-6-14(7-9-15)17-12-24-19(21-17)16(11-20)18(22)10-13-4-2-3-5-13/h2,4,6-9,12-13,16H,3,5,10H2,1H3/t13-,16+/m0/s1 |
| InChIKey | NXNBRXXYEAJERZ-XJKSGUPXSA-N |
| XLogP | 4.35 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|