C18H19N3O2S — CID 51200440
N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-2-cyclopent-2-en-1-ylacetamide (PubChem CID 51200440) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-2-cyclopent-2-en-1-ylacetamide.
| Compound Name | N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-2-cyclopent-2-en-1-ylacetamide |
|---|---|
| PubChem CID | 51200440 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-2-cyclopent-2-en-1-ylacetamide |
| SMILES | CC(=O)Nc1ccc(-c2csc(NC(=O)CC3C=CCC3)n2)cc1 |
| InChI | InChI=1S/C18H19N3O2S/c1-12(22)19-15-8-6-14(7-9-15)16-11-24-18(20-16)21-17(23)10-13-4-2-3-5-13/h2,4,6-9,11,13H,3,5,10H2,1H3,(H,19,22)(H,20,21,23) |
| InChIKey | INZNDSGTKDWTKT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|