C17H19N3O3S2 — CID 25325724
2-[(1S)-cyclopent-2-en-1-yl]-N-[4-[4-(methanesulfonamido)phenyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 25325724) has the molecular formula C17H19N3O3S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-[(1S)-cyclopent-2-en-1-yl]-N-[4-[4-(methanesulfonamido)phenyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[4-[4-(methanesulfonamido)phenyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 25325724 |
| Molecular Formula | C17H19N3O3S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[4-[4-(methanesulfonamido)phenyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2csc(NC(=O)C[C@H]3C=CCC3)n2)cc1 |
| InChI | InChI=1S/C17H19N3O3S2/c1-25(22,23)20-14-8-6-13(7-9-14)15-11-24-17(18-15)19-16(21)10-12-4-2-3-5-12/h2,4,6-9,11-12,20H,3,5,10H2,1H3,(H,18,19,21)/t12-/m0/s1 |
| InChIKey | BTPSJKICLIDYJJ-LBPRGKRZSA-N |
| XLogP | 3.48 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|