C17H18N2OS — CID 8534279
2-[(1S)-cyclopent-2-en-1-yl]-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide (PubChem CID 8534279) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-[(1S)-cyclopent-2-en-1-yl]-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide.
| Compound Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 8534279 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-[(1S)-cyclopent-2-en-1-yl]-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide |
| SMILES | Cc1nc(-c2ccc(NC(=O)C[C@H]3C=CCC3)cc2)cs1 |
| InChI | InChI=1S/C17H18N2OS/c1-12-18-16(11-21-12)14-6-8-15(9-7-14)19-17(20)10-13-4-2-3-5-13/h2,4,6-9,11,13H,3,5,10H2,1H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | GPIGMPZVWIAEEN-ZDUSSCGKSA-N |
| XLogP | 4.41 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|