C16H15BrN2OS — CID 55384138
N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-cyclopent-2-en-1-ylacetamide (PubChem CID 55384138) has the molecular formula C16H15BrN2OS and a molecular weight of 363.28 g/mol. Its IUPAC name is N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-cyclopent-2-en-1-ylacetamide.
| Compound Name | N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-cyclopent-2-en-1-ylacetamide |
|---|---|
| PubChem CID | 55384138 |
| Molecular Formula | C16H15BrN2OS |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-cyclopent-2-en-1-ylacetamide |
| SMILES | O=C(CC1C=CCC1)Nc1nc(-c2cccc(Br)c2)cs1 |
| InChI | InChI=1S/C16H15BrN2OS/c17-13-7-3-6-12(9-13)14-10-21-16(18-14)19-15(20)8-11-4-1-2-5-11/h1,3-4,6-7,9-11H,2,5,8H2,(H,18,19,20) |
| InChIKey | PIAVZWLKEXUYCW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|