C19H17BrN2O3S — CID 23959263
[2-[[4-(3-bromophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 23959263) has the molecular formula C19H17BrN2O3S and a molecular weight of 433.33 g/mol. Its IUPAC name is [2-[[4-(3-bromophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [2-[[4-(3-bromophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 23959263 |
| Molecular Formula | C19H17BrN2O3S |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | [2-[[4-(3-bromophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(COC(=O)C1CC2C=CC1C2)Nc1nc(-c2cccc(Br)c2)cs1 |
| InChI | InChI=1S/C19H17BrN2O3S/c20-14-3-1-2-13(8-14)16-10-26-19(21-16)22-17(23)9-25-18(24)15-7-11-4-5-12(15)6-11/h1-5,8,10-12,15H,6-7,9H2,(H,21,22,23) |
| InChIKey | VJTVKKLQYPLHGA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|