C14H17BrClN3O2S — CID 119676953
N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride (PubChem CID 119676953) has the molecular formula C14H17BrClN3O2S and a molecular weight of 406.73 g/mol. Its IUPAC name is N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride.
| Compound Name | N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119676953 |
| Molecular Formula | C14H17BrClN3O2S |
| Molecular Weight | 406.73 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)Nc1nc(-c2cccc(Br)c2)cs1.Cl |
| InChI | InChI=1S/C14H16BrN3O2S.ClH/c1-20-6-5-16-8-13(19)18-14-17-12(9-21-14)10-3-2-4-11(15)7-10;/h2-4,7,9,16H,5-6,8H2,1H3,(H,17,18,19);1H |
| InChIKey | IDARTFLECCILEI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.73 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|