C14H18ClN3O2S — CID 119670239
2-(2-methoxyethylamino)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide;hydrochloride (PubChem CID 119670239) has the molecular formula C14H18ClN3O2S and a molecular weight of 327.84 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide;hydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119670239 |
| Molecular Formula | C14H18ClN3O2S |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)Nc1nc(-c2ccccc2)cs1.Cl |
| InChI | InChI=1S/C14H17N3O2S.ClH/c1-19-8-7-15-9-13(18)17-14-16-12(10-20-14)11-5-3-2-4-6-11;/h2-6,10,15H,7-9H2,1H3,(H,16,17,18);1H |
| InChIKey | KUSBOALAYZUKEN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|