C10H17N3O2S — CID 42769830
2-(3-methoxypropylamino)-N-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 42769830) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-(3-methoxypropylamino)-N-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(3-methoxypropylamino)-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 42769830 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2-(3-methoxypropylamino)-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | COCCCNCC(=O)Nc1nc(C)cs1 |
| InChI | InChI=1S/C10H17N3O2S/c1-8-7-16-10(12-8)13-9(14)6-11-4-3-5-15-2/h7,11H,3-6H2,1-2H3,(H,12,13,14) |
| InChIKey | IARDGGNQKHYPFL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|