C9H14N2O3S — CID 43037447
2-(2-methoxyethoxy)-N-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 43037447) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(2-methoxyethoxy)-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 43037447 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | COCCOCC(=O)Nc1nc(C)cs1 |
| InChI | InChI=1S/C9H14N2O3S/c1-7-6-15-9(10-7)11-8(12)5-14-4-3-13-2/h6H,3-5H2,1-2H3,(H,10,11,12) |
| InChIKey | HNEUMQUFCTUNQC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|