C9H14N2O4 — CID 103718778
2-(2-methoxyethoxy)-N-(4-methyl-1,3-oxazol-2-yl)acetamide (PubChem CID 103718778) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-(4-methyl-1,3-oxazol-2-yl)acetamide.
| Compound Name | 2-(2-methoxyethoxy)-N-(4-methyl-1,3-oxazol-2-yl)acetamide |
|---|---|
| PubChem CID | 103718778 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-(4-methyl-1,3-oxazol-2-yl)acetamide |
| SMILES | COCCOCC(=O)Nc1nc(C)co1 |
| InChI | InChI=1S/C9H14N2O4/c1-7-5-15-9(10-7)11-8(12)6-14-4-3-13-2/h5H,3-4,6H2,1-2H3,(H,10,11,12) |
| InChIKey | BRWNDQYLLRAQMQ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|