C10H13BrN2O3 — CID 103789411
N-(6-bromo-3-pyridinyl)-2-(2-methoxyethoxy)acetamide (PubChem CID 103789411) has the molecular formula C10H13BrN2O3 and a molecular weight of 289.13 g/mol. Its IUPAC name is N-(6-bromo-3-pyridinyl)-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-(6-bromo-3-pyridinyl)-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 103789411 |
| Molecular Formula | C10H13BrN2O3 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | N-(6-bromo-3-pyridinyl)-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)Nc1ccc(Br)nc1 |
| InChI | InChI=1S/C10H13BrN2O3/c1-15-4-5-16-7-10(14)13-8-2-3-9(11)12-6-8/h2-3,6H,4-5,7H2,1H3,(H,13,14) |
| InChIKey | SZWLHMOPUYGDGN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|