About butane;ethane;methyl N-(6-bromo-3-pyridinyl)carbamate
butane;ethane;methyl N-(6-bromo-3-pyridinyl)carbamate (PubChem CID 155739077) has the molecular formula C13H23BrN2O2
and a molecular weight of 319.24 g/mol. Its IUPAC name is butane;ethane;methyl N-(6-bromo-3-pyridinyl)carbamate.
Molecular Properties
| Compound Name | butane;ethane;methyl N-(6-bromo-3-pyridinyl)carbamate |
| PubChem CID | 155739077 |
| Molecular Formula | C13H23BrN2O2 |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | butane;ethane;methyl N-(6-bromo-3-pyridinyl)carbamate |
| SMILES | CC.CCCC.COC(=O)Nc1ccc(Br)nc1 |
| InChI | InChI=1S/C7H7BrN2O2.C4H10.C2H6/c1-12-7(11)10-5-2-3-6(8)9-4-5;1-3-4-2;1-2/h2-4H,1H3,(H,10,11);3-4H2,1-2H3;1-2H3 |
| InChIKey | YGYDTTMFPPZMJA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze butane;ethane;methyl N-(6-bromo-3-pyridinyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;ethane;methyl N-(6-bromo-3-pyridinyl)carbamate?
The IUPAC name of butane;ethane;methyl N-(6-bromo-3-pyridinyl)carbamate (CID 155739077) is butane;ethane;methyl N-(6-bromo-3-pyridinyl)carbamate.
What is the SMILES notation for butane;ethane;methyl N-(6-bromo-3-pyridinyl)carbamate?
The canonical SMILES for butane;ethane;methyl N-(6-bromo-3-pyridinyl)carbamate is CC.CCCC.COC(=O)Nc1ccc(Br)nc1.
What is the InChIKey of butane;ethane;methyl N-(6-bromo-3-pyridinyl)carbamate?
The InChIKey is YGYDTTMFPPZMJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrN2O2.C4H10.C2H6/c1-12-7(11)10-5-2-3-6(8)9-4-5;1-3-4-2;1-2/h2-4H,1H3,(H,10,11);3-4H2,1-2H3;1-2H3.
What are the key properties of butane;ethane;methyl N-(6-bromo-3-pyridinyl)carbamate?
butane;ethane;methyl N-(6-bromo-3-pyridinyl)carbamate has a molecular weight of 319.24 g/mol, XLogP of 4.86, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane;ethane;methyl N-(6-bromo-3-pyridinyl)carbamate is sourced from PubChem (CID 155739077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).