C11H20N4OS — CID 4088039
2-[3-(dimethylamino)propylamino]-N-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 4088039) has the molecular formula C11H20N4OS and a molecular weight of 256.37 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propylamino]-N-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[3-(dimethylamino)propylamino]-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 4088039 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-[3-(dimethylamino)propylamino]-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1csc(NC(=O)CNCCCN(C)C)n1 |
| InChI | InChI=1S/C11H20N4OS/c1-9-8-17-11(13-9)14-10(16)7-12-5-4-6-15(2)3/h8,12H,4-7H2,1-3H3,(H,13,14,16) |
| InChIKey | SFVMXWAPANBKOJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|