C17H17N3O3S — CID 8541420
3-(2,5-dioxopyrrolidin-1-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]propanamide (PubChem CID 8541420) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 8541420 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]propanamide |
| SMILES | Cc1nc(-c2ccc(NC(=O)CCN3C(=O)CCC3=O)cc2)cs1 |
| InChI | InChI=1S/C17H17N3O3S/c1-11-18-14(10-24-11)12-2-4-13(5-3-12)19-15(21)8-9-20-16(22)6-7-17(20)23/h2-5,10H,6-9H2,1H3,(H,19,21) |
| InChIKey | SKVMPVXSLREBRK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|