C23H21N3O3S — CID 46970977
2-(2,6-dioxo-4-phenylpiperidin-1-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide (PubChem CID 46970977) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is 2-(2,6-dioxo-4-phenylpiperidin-1-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide.
| Compound Name | 2-(2,6-dioxo-4-phenylpiperidin-1-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 46970977 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 2-(2,6-dioxo-4-phenylpiperidin-1-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]acetamide |
| SMILES | Cc1nc(-c2ccc(NC(=O)CN3C(=O)CC(c4ccccc4)CC3=O)cc2)cs1 |
| InChI | InChI=1S/C23H21N3O3S/c1-15-24-20(14-30-15)17-7-9-19(10-8-17)25-21(27)13-26-22(28)11-18(12-23(26)29)16-5-3-2-4-6-16/h2-10,14,18H,11-13H2,1H3,(H,25,27) |
| InChIKey | FVYQIOHXPJAVRY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|