C21H24N4O3S — CID 8534304
4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]butanamide (PubChem CID 8534304) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]butanamide.
| Compound Name | 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 8534304 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]butanamide |
| SMILES | Cc1nc(-c2ccc(NC(=O)CCCN3C(=O)NC4(CCCC4)C3=O)cc2)cs1 |
| InChI | InChI=1S/C21H24N4O3S/c1-14-22-17(13-29-14)15-6-8-16(9-7-15)23-18(26)5-4-12-25-19(27)21(24-20(25)28)10-2-3-11-21/h6-9,13H,2-5,10-12H2,1H3,(H,23,26)(H,24,28) |
| InChIKey | LDRGQAKBMMVHLK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|