C15H15ClN4O7 — CID 92530972
dimethyl (2E,3S)-2-(carbamoylhydrazinylidene)-3-[2-(4-chloroanilino)-2-oxoacetyl]butanedioate (PubChem CID 92530972) has the molecular formula C15H15ClN4O7 and a molecular weight of 398.76 g/mol. Its IUPAC name is dimethyl (2E,3S)-2-(carbamoylhydrazinylidene)-3-[2-(4-chloroanilino)-2-oxoacetyl]butanedioate.
| Compound Name | dimethyl (2E,3S)-2-(carbamoylhydrazinylidene)-3-[2-(4-chloroanilino)-2-oxoacetyl]butanedioate |
|---|---|
| PubChem CID | 92530972 |
| Molecular Formula | C15H15ClN4O7 |
| Molecular Weight | 398.76 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | dimethyl (2E,3S)-2-(carbamoylhydrazinylidene)-3-[2-(4-chloroanilino)-2-oxoacetyl]butanedioate |
| SMILES | COC(=O)/C(=N/NC(N)=O)[C@H](C(=O)OC)C(=O)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H15ClN4O7/c1-26-13(23)9(10(14(24)27-2)19-20-15(17)25)11(21)12(22)18-8-5-3-7(16)4-6-8/h3-6,9H,1-2H3,(H,18,22)(H3,17,20,25)/b19-10+/t9-/m0/s1 |
| InChIKey | KUAQIOGYHHOVDZ-XHYWODOQSA-N |
| XLogP | -0.17 |
| TPSA | 166.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.76 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|