C16H12Cl2N4O3S — CID 4593452
2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-N-(2-chloro-5-nitrophenyl)propanamide (PubChem CID 4593452) has the molecular formula C16H12Cl2N4O3S and a molecular weight of 411.27 g/mol. Its IUPAC name is 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-N-(2-chloro-5-nitrophenyl)propanamide.
| Compound Name | 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-N-(2-chloro-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 4593452 |
| Molecular Formula | C16H12Cl2N4O3S |
| Molecular Weight | 411.27 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-N-(2-chloro-5-nitrophenyl)propanamide |
| SMILES | CC(Sc1nc2ccc(Cl)cc2[nH]1)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C16H12Cl2N4O3S/c1-8(26-16-20-12-5-2-9(17)6-14(12)21-16)15(23)19-13-7-10(22(24)25)3-4-11(13)18/h2-8H,1H3,(H,19,23)(H,20,21) |
| InChIKey | JHKYOEHBZVXANJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.27 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|