C18H14ClFN4O3S — CID 46825626
N-(2-chloro-5-nitrophenyl)-2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]sulfanyl]propanamide (PubChem CID 46825626) has the molecular formula C18H14ClFN4O3S and a molecular weight of 420.85 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]sulfanyl]propanamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 46825626 |
| Molecular Formula | C18H14ClFN4O3S |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]sulfanyl]propanamide |
| SMILES | CC(Sc1ncc(-c2ccc(F)cc2)[nH]1)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C18H14ClFN4O3S/c1-10(17(25)22-15-8-13(24(26)27)6-7-14(15)19)28-18-21-9-16(23-18)11-2-4-12(20)5-3-11/h2-10H,1H3,(H,21,23)(H,22,25) |
| InChIKey | YPTSTFRBHUDMNW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|