C17H14ClFN4OS — CID 46825569
N-(5-chloro-2-pyridinyl)-2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]sulfanyl]propanamide (PubChem CID 46825569) has the molecular formula C17H14ClFN4OS and a molecular weight of 376.84 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]sulfanyl]propanamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 46825569 |
| Molecular Formula | C17H14ClFN4OS |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]sulfanyl]propanamide |
| SMILES | CC(Sc1ncc(-c2ccc(F)cc2)[nH]1)C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C17H14ClFN4OS/c1-10(16(24)23-15-7-4-12(18)8-20-15)25-17-21-9-14(22-17)11-2-5-13(19)6-3-11/h2-10H,1H3,(H,21,22)(H,20,23,24) |
| InChIKey | AVPZBLXTJVGCSH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |