C13H15N3O3S — CID 27209722
N-[(2R)-2-hydroxypropyl]-2-[(3-oxo-4H-quinoxalin-2-yl)sulfanyl]acetamide (PubChem CID 27209722) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is N-[(2R)-2-hydroxypropyl]-2-[(3-oxo-4H-quinoxalin-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(2R)-2-hydroxypropyl]-2-[(3-oxo-4H-quinoxalin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 27209722 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-[(2R)-2-hydroxypropyl]-2-[(3-oxo-4H-quinoxalin-2-yl)sulfanyl]acetamide |
| SMILES | C[C@@H](O)CNC(=O)CSc1nc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C13H15N3O3S/c1-8(17)6-14-11(18)7-20-13-12(19)15-9-4-2-3-5-10(9)16-13/h2-5,8,17H,6-7H2,1H3,(H,14,18)(H,15,19)/t8-/m1/s1 |
| InChIKey | CQTJSBMJHJOJQC-MRVPVSSYSA-N |
| XLogP | 0.51 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |