C13H15N3O2S — CID 40543272
N-[(2R)-2-hydroxypropyl]-2-phthalazin-1-ylsulfanylacetamide (PubChem CID 40543272) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is N-[(2R)-2-hydroxypropyl]-2-phthalazin-1-ylsulfanylacetamide.
| Compound Name | N-[(2R)-2-hydroxypropyl]-2-phthalazin-1-ylsulfanylacetamide |
|---|---|
| PubChem CID | 40543272 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-[(2R)-2-hydroxypropyl]-2-phthalazin-1-ylsulfanylacetamide |
| SMILES | C[C@@H](O)CNC(=O)CSc1nncc2ccccc12 |
| InChI | InChI=1S/C13H15N3O2S/c1-9(17)6-14-12(18)8-19-13-11-5-3-2-4-10(11)7-15-16-13/h2-5,7,9,17H,6,8H2,1H3,(H,14,18)/t9-/m1/s1 |
| InChIKey | BIAZCMRCOKYIFG-SECBINFHSA-N |
| XLogP | 1.22 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |