C11H12N2O2S — CID 79682620
3-phthalazin-1-ylsulfanylpropane-1,2-diol (PubChem CID 79682620) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 3-phthalazin-1-ylsulfanylpropane-1,2-diol.
| Compound Name | 3-phthalazin-1-ylsulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 79682620 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 3-phthalazin-1-ylsulfanylpropane-1,2-diol |
| SMILES | OCC(O)CSc1nncc2ccccc12 |
| InChI | InChI=1S/C11H12N2O2S/c14-6-9(15)7-16-11-10-4-2-1-3-8(10)5-12-13-11/h1-5,9,14-15H,6-7H2 |
| InChIKey | HWEHUYISFQIGQM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |