C16H11Cl2N3OS — CID 134025550
N-(3,4-dichlorophenyl)-2-phthalazin-1-ylsulfanylacetamide (PubChem CID 134025550) has the molecular formula C16H11Cl2N3OS and a molecular weight of 364.26 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-phthalazin-1-ylsulfanylacetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-phthalazin-1-ylsulfanylacetamide |
|---|---|
| PubChem CID | 134025550 |
| Molecular Formula | C16H11Cl2N3OS |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-phthalazin-1-ylsulfanylacetamide |
| SMILES | O=C(CSc1nncc2ccccc12)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2N3OS/c17-13-6-5-11(7-14(13)18)20-15(22)9-23-16-12-4-2-1-3-10(12)8-19-21-16/h1-8H,9H2,(H,20,22) |
| InChIKey | ZQSLKSLYQFRTRF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |