C15H20N4OS — CID 6411504
N-[3-(dimethylamino)propyl]-2-phthalazin-1-ylsulfanylacetamide (PubChem CID 6411504) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-phthalazin-1-ylsulfanylacetamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-phthalazin-1-ylsulfanylacetamide |
|---|---|
| PubChem CID | 6411504 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-phthalazin-1-ylsulfanylacetamide |
| SMILES | CN(C)CCCNC(=O)CSc1nncc2ccccc12 |
| InChI | InChI=1S/C15H20N4OS/c1-19(2)9-5-8-16-14(20)11-21-15-13-7-4-3-6-12(13)10-17-18-15/h3-4,6-7,10H,5,8-9,11H2,1-2H3,(H,16,20) |
| InChIKey | ADLJRWGKCFNAEA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|