C16H22ClN3O — CID 134126097
1-[3-(dimethylamino)propyl]-3-naphthalen-1-ylurea;hydrochloride (PubChem CID 134126097) has the molecular formula C16H22ClN3O and a molecular weight of 307.82 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-naphthalen-1-ylurea;hydrochloride.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-naphthalen-1-ylurea;hydrochloride |
|---|---|
| PubChem CID | 134126097 |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-naphthalen-1-ylurea;hydrochloride |
| SMILES | CN(C)CCCNC(=O)Nc1cccc2ccccc12.Cl |
| InChI | InChI=1S/C16H21N3O.ClH/c1-19(2)12-6-11-17-16(20)18-15-10-5-8-13-7-3-4-9-14(13)15;/h3-5,7-10H,6,11-12H2,1-2H3,(H2,17,18,20);1H |
| InChIKey | HRGUYLZSRHKPMG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|