C19H23N3O3 — CID 70114830
2-[2-[3-(dimethylamino)propylcarbamoylamino]phenyl]benzoic acid (PubChem CID 70114830) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-[2-[3-(dimethylamino)propylcarbamoylamino]phenyl]benzoic acid.
| Compound Name | 2-[2-[3-(dimethylamino)propylcarbamoylamino]phenyl]benzoic acid |
|---|---|
| PubChem CID | 70114830 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 2-[2-[3-(dimethylamino)propylcarbamoylamino]phenyl]benzoic acid |
| SMILES | CN(C)CCCNC(=O)Nc1ccccc1-c1ccccc1C(=O)O |
| InChI | InChI=1S/C19H23N3O3/c1-22(2)13-7-12-20-19(25)21-17-11-6-5-9-15(17)14-8-3-4-10-16(14)18(23)24/h3-6,8-11H,7,12-13H2,1-2H3,(H,23,24)(H2,20,21,25) |
| InChIKey | LCWASYGSXBFYNN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|