C17H18F3N3OS — CID 71898581
2-phthalazin-1-ylsulfanyl-N-[2-(trifluoromethyl)cyclohexyl]acetamide (PubChem CID 71898581) has the molecular formula C17H18F3N3OS and a molecular weight of 369.41 g/mol. Its IUPAC name is 2-phthalazin-1-ylsulfanyl-N-[2-(trifluoromethyl)cyclohexyl]acetamide.
| Compound Name | 2-phthalazin-1-ylsulfanyl-N-[2-(trifluoromethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 71898581 |
| Molecular Formula | C17H18F3N3OS |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 2-phthalazin-1-ylsulfanyl-N-[2-(trifluoromethyl)cyclohexyl]acetamide |
| SMILES | O=C(CSc1nncc2ccccc12)NC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C17H18F3N3OS/c18-17(19,20)13-7-3-4-8-14(13)22-15(24)10-25-16-12-6-2-1-5-11(12)9-21-23-16/h1-2,5-6,9,13-14H,3-4,7-8,10H2,(H,22,24) |
| InChIKey | GLHYZCSYFDFZFI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |