C18H19BO4 — CID 175202639
[4-phenyl-2,6-di(propanoyl)phenyl]boronic acid (PubChem CID 175202639) has the molecular formula C18H19BO4 and a molecular weight of 310.16 g/mol. Its IUPAC name is [4-phenyl-2,6-di(propanoyl)phenyl]boronic acid.
| Compound Name | [4-phenyl-2,6-di(propanoyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 175202639 |
| Molecular Formula | C18H19BO4 |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | [4-phenyl-2,6-di(propanoyl)phenyl]boronic acid |
| SMILES | CCC(=O)c1cc(-c2ccccc2)cc(C(=O)CC)c1B(O)O |
| InChI | InChI=1S/C18H19BO4/c1-3-16(20)14-10-13(12-8-6-5-7-9-12)11-15(17(21)4-2)18(14)19(22)23/h5-11,22-23H,3-4H2,1-2H3 |
| InChIKey | FPAWWZIXKITSOG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|