C36H36BClN2O2 — CID 159270306
2-chloro-4-methylquinoline;(3,5-dimethylphenyl)boronic acid;2-(3,5-dimethylphenyl)-4-methylquinoline (PubChem CID 159270306) has the molecular formula C36H36BClN2O2 and a molecular weight of 574.96 g/mol. Its IUPAC name is 2-chloro-4-methylquinoline;(3,5-dimethylphenyl)boronic acid;2-(3,5-dimethylphenyl)-4-methylquinoline.
| Compound Name | 2-chloro-4-methylquinoline;(3,5-dimethylphenyl)boronic acid;2-(3,5-dimethylphenyl)-4-methylquinoline |
|---|---|
| PubChem CID | 159270306 |
| Molecular Formula | C36H36BClN2O2 |
| Molecular Weight | 574.96 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 2-chloro-4-methylquinoline;(3,5-dimethylphenyl)boronic acid;2-(3,5-dimethylphenyl)-4-methylquinoline |
| SMILES | Cc1cc(C)cc(-c2cc(C)c3ccccc3n2)c1.Cc1cc(C)cc(B(O)O)c1.Cc1cc(Cl)nc2ccccc12 |
| InChI | InChI=1S/C18H17N.C10H8ClN.C8H11BO2/c1-12-8-13(2)10-15(9-12)18-11-14(3)16-6-4-5-7-17(16)19-18;1-7-6-10(11)12-9-5-3-2-4-8(7)9;1-6-3-7(2)5-8(4-6)9(10)11/h4-11H,1-3H3;2-6H,1H3;3-5,10-11H,1-2H3 |
| InChIKey | KXPYSCODTKJMKI-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.96 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|