C18H13ClN2O2 — CID 135493823
7-chloro-3-[(1Z,3E)-2-hydroxy-4-phenylbuta-1,3-dienyl]-1H-quinoxalin-2-one (PubChem CID 135493823) has the molecular formula C18H13ClN2O2 and a molecular weight of 324.77 g/mol. Its IUPAC name is 7-chloro-3-[(1Z,3E)-2-hydroxy-4-phenylbuta-1,3-dienyl]-1H-quinoxalin-2-one.
| Compound Name | 7-chloro-3-[(1Z,3E)-2-hydroxy-4-phenylbuta-1,3-dienyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 135493823 |
| Molecular Formula | C18H13ClN2O2 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 7-chloro-3-[(1Z,3E)-2-hydroxy-4-phenylbuta-1,3-dienyl]-1H-quinoxalin-2-one |
| SMILES | O=c1[nH]c2cc(Cl)ccc2nc1/C=C(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C18H13ClN2O2/c19-13-7-9-15-16(10-13)21-18(23)17(20-15)11-14(22)8-6-12-4-2-1-3-5-12/h1-11,22H,(H,21,23)/b8-6+,14-11- |
| InChIKey | GLPPKUKSQRSNGV-SQKGQWCESA-N |
| XLogP | 4.19 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|