C13H10N4O3 — CID 136882696
6-[2-hydroxy-2-(4-methylphenyl)ethenyl]-4H-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-one (PubChem CID 136882696) has the molecular formula C13H10N4O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is 6-[2-hydroxy-2-(4-methylphenyl)ethenyl]-4H-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-one.
| Compound Name | 6-[2-hydroxy-2-(4-methylphenyl)ethenyl]-4H-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-one |
|---|---|
| PubChem CID | 136882696 |
| Molecular Formula | C13H10N4O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 6-[2-hydroxy-2-(4-methylphenyl)ethenyl]-4H-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-one |
| SMILES | Cc1ccc(C(O)=Cc2nc3nonc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C13H10N4O3/c1-7-2-4-8(5-3-7)10(18)6-9-13(19)15-12-11(14-9)16-20-17-12/h2-6,18H,1H3,(H,15,17,19) |
| InChIKey | NUFMBYVLHSFTEB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|