C19H12N2O4 — CID 135408332
2-[(Z)-2-hydroxy-2-phenylethenyl]-4H-chromeno[3,4-b]pyrazine-3,5-dione (PubChem CID 135408332) has the molecular formula C19H12N2O4 and a molecular weight of 332.32 g/mol. Its IUPAC name is 2-[(Z)-2-hydroxy-2-phenylethenyl]-4H-chromeno[3,4-b]pyrazine-3,5-dione.
| Compound Name | 2-[(Z)-2-hydroxy-2-phenylethenyl]-4H-chromeno[3,4-b]pyrazine-3,5-dione |
|---|---|
| PubChem CID | 135408332 |
| Molecular Formula | C19H12N2O4 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2-[(Z)-2-hydroxy-2-phenylethenyl]-4H-chromeno[3,4-b]pyrazine-3,5-dione |
| SMILES | O=c1[nH]c2c(=O)oc3ccccc3c2nc1/C=C(\O)c1ccccc1 |
| InChI | InChI=1S/C19H12N2O4/c22-14(11-6-2-1-3-7-11)10-13-18(23)21-17-16(20-13)12-8-4-5-9-15(12)25-19(17)24/h1-10,22H,(H,21,23)/b14-10- |
| InChIKey | WNNANFNNARKBTK-UVTDQMKNSA-N |
| XLogP | 3.09 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|