C11H16N3S+ — CID 7008936
[(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]azanium (PubChem CID 7008936) has the molecular formula C11H16N3S+ and a molecular weight of 222.34 g/mol. Its IUPAC name is [(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]azanium.
| Compound Name | [(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]azanium |
|---|---|
| PubChem CID | 7008936 |
| Molecular Formula | C11H16N3S+ |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | [(1S)-1-(1H-benzimidazol-2-yl)-3-methylsulfanylpropyl]azanium |
| SMILES | CSCC[C@H]([NH3+])c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H15N3S/c1-15-7-6-8(12)11-13-9-4-2-3-5-10(9)14-11/h2-5,8H,6-7,12H2,1H3,(H,13,14)/p+1/t8-/m0/s1 |
| InChIKey | WWNOVKZOKFLYAF-QMMMGPOBSA-O |
| XLogP | 1.60 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |