C18H21N5O3 — CID 91222350
N-[4-[1-(2,6-dioxo-3,7-dihydropurin-8-yl)-2-methylbutyl]phenyl]acetamide (PubChem CID 91222350) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is N-[4-[1-(2,6-dioxo-3,7-dihydropurin-8-yl)-2-methylbutyl]phenyl]acetamide.
| Compound Name | N-[4-[1-(2,6-dioxo-3,7-dihydropurin-8-yl)-2-methylbutyl]phenyl]acetamide |
|---|---|
| PubChem CID | 91222350 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-[4-[1-(2,6-dioxo-3,7-dihydropurin-8-yl)-2-methylbutyl]phenyl]acetamide |
| SMILES | CCC(C)C(c1ccc(NC(C)=O)cc1)c1nc2[nH]c(=O)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C18H21N5O3/c1-4-9(2)13(11-5-7-12(8-6-11)19-10(3)24)15-20-14-16(21-15)22-18(26)23-17(14)25/h5-9,13H,4H2,1-3H3,(H,19,24)(H3,20,21,22,23,25,26) |
| InChIKey | KGMUDZJOJMOPIZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 123.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |