C22H28N4O3 — CID 67787935
8-[3-cyclopentyl-5-(4-methoxyphenyl)pentyl]-3,7-dihydropurine-2,6-dione (PubChem CID 67787935) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 8-[3-cyclopentyl-5-(4-methoxyphenyl)pentyl]-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-[3-cyclopentyl-5-(4-methoxyphenyl)pentyl]-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 67787935 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 8-[3-cyclopentyl-5-(4-methoxyphenyl)pentyl]-3,7-dihydropurine-2,6-dione |
| SMILES | COc1ccc(CCC(CCc2nc3[nH]c(=O)[nH]c(=O)c3[nH]2)C2CCCC2)cc1 |
| InChI | InChI=1S/C22H28N4O3/c1-29-17-11-7-14(8-12-17)6-9-16(15-4-2-3-5-15)10-13-18-23-19-20(24-18)25-22(28)26-21(19)27/h7-8,11-12,15-16H,2-6,9-10,13H2,1H3,(H3,23,24,25,26,27,28) |
| InChIKey | XCKSEDNOEMQCHP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |