C10H15N5O2 — CID 136680651
2-amino-8-(2-methoxy-2-methylpropyl)-1,7-dihydropurin-6-one (PubChem CID 136680651) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-amino-8-(2-methoxy-2-methylpropyl)-1,7-dihydropurin-6-one.
| Compound Name | 2-amino-8-(2-methoxy-2-methylpropyl)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 136680651 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-amino-8-(2-methoxy-2-methylpropyl)-1,7-dihydropurin-6-one |
| SMILES | COC(C)(C)Cc1nc2nc(N)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C10H15N5O2/c1-10(2,17-3)4-5-12-6-7(13-5)14-9(11)15-8(6)16/h4H2,1-3H3,(H4,11,12,13,14,15,16) |
| InChIKey | RUWGYJGQZLUUQN-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |