C5H8N4O2 — CID 118167344
2,5-diamino-4-methoxy-1H-pyrimidin-6-one (PubChem CID 118167344) has the molecular formula C5H8N4O2 and a molecular weight of 156.15 g/mol. Its IUPAC name is 2,5-diamino-4-methoxy-1H-pyrimidin-6-one.
| Compound Name | 2,5-diamino-4-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 118167344 |
| Molecular Formula | C5H8N4O2 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 2,5-diamino-4-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1nc(N)[nH]c(=O)c1N |
| InChI | InChI=1S/C5H8N4O2/c1-11-4-2(6)3(10)8-5(7)9-4/h6H2,1H3,(H3,7,8,9,10) |
| InChIKey | GYTAEFSVKBSPSN-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |