C6H11N5O — CID 137221313
2,5-diamino-4-(ethylamino)-1H-pyrimidin-6-one (PubChem CID 137221313) has the molecular formula C6H11N5O and a molecular weight of 169.19 g/mol. Its IUPAC name is 2,5-diamino-4-(ethylamino)-1H-pyrimidin-6-one.
| Compound Name | 2,5-diamino-4-(ethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137221313 |
| Molecular Formula | C6H11N5O |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | 2,5-diamino-4-(ethylamino)-1H-pyrimidin-6-one |
| SMILES | CCNc1nc(N)[nH]c(=O)c1N |
| InChI | InChI=1S/C6H11N5O/c1-2-9-4-3(7)5(12)11-6(8)10-4/h2,7H2,1H3,(H4,8,9,10,11,12) |
| InChIKey | WYGJPMMLMZEPRS-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |