C4H7N3OS — CID 70294901
4-(ethylamino)-1,2,5-thiadiazol-3-one (PubChem CID 70294901) has the molecular formula C4H7N3OS and a molecular weight of 145.19 g/mol. Its IUPAC name is 4-(ethylamino)-1,2,5-thiadiazol-3-one.
| Compound Name | 4-(ethylamino)-1,2,5-thiadiazol-3-one |
|---|---|
| PubChem CID | 70294901 |
| Molecular Formula | C4H7N3OS |
| Molecular Weight | 145.19 g/mol |
| Exact Mass | 145.03 |
| IUPAC Name | 4-(ethylamino)-1,2,5-thiadiazol-3-one |
| SMILES | CCNc1ns[nH]c1=O |
| InChI | InChI=1S/C4H7N3OS/c1-2-5-3-4(8)7-9-6-3/h2H2,1H3,(H,5,6)(H,7,8) |
| InChIKey | SBGUBCIOKXLQSD-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.19 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |