C11H14N4O2 — CID 62465248
3-[[2-(ethylamino)-3-pyridinyl]methyl]imidazolidine-2,4-dione (PubChem CID 62465248) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 3-[[2-(ethylamino)-3-pyridinyl]methyl]imidazolidine-2,4-dione.
| Compound Name | 3-[[2-(ethylamino)-3-pyridinyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 62465248 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 3-[[2-(ethylamino)-3-pyridinyl]methyl]imidazolidine-2,4-dione |
| SMILES | CCNc1ncccc1CN1C(=O)CNC1=O |
| InChI | InChI=1S/C11H14N4O2/c1-2-12-10-8(4-3-5-13-10)7-15-9(16)6-14-11(15)17/h3-5H,2,6-7H2,1H3,(H,12,13)(H,14,17) |
| InChIKey | CAHGAXBKWPMIIN-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|