C14H14F3N3O — CID 81310127
1-[[2-(ethylamino)-3-pyridinyl]methyl]-6-(trifluoromethyl)pyridin-2-one (PubChem CID 81310127) has the molecular formula C14H14F3N3O and a molecular weight of 297.28 g/mol. Its IUPAC name is 1-[[2-(ethylamino)-3-pyridinyl]methyl]-6-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[[2-(ethylamino)-3-pyridinyl]methyl]-6-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 81310127 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-[[2-(ethylamino)-3-pyridinyl]methyl]-6-(trifluoromethyl)pyridin-2-one |
| SMILES | CCNc1ncccc1Cn1c(C(F)(F)F)cccc1=O |
| InChI | InChI=1S/C14H14F3N3O/c1-2-18-13-10(5-4-8-19-13)9-20-11(14(15,16)17)6-3-7-12(20)21/h3-8H,2,9H2,1H3,(H,18,19) |
| InChIKey | XUCDLYOJRLNUOZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |