C11H11F3N4OS — CID 81318910
1-[[5-(ethylamino)thiadiazol-4-yl]methyl]-6-(trifluoromethyl)pyridin-2-one (PubChem CID 81318910) has the molecular formula C11H11F3N4OS and a molecular weight of 304.30 g/mol. Its IUPAC name is 1-[[5-(ethylamino)thiadiazol-4-yl]methyl]-6-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[[5-(ethylamino)thiadiazol-4-yl]methyl]-6-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 81318910 |
| Molecular Formula | C11H11F3N4OS |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 1-[[5-(ethylamino)thiadiazol-4-yl]methyl]-6-(trifluoromethyl)pyridin-2-one |
| SMILES | CCNc1snnc1Cn1c(C(F)(F)F)cccc1=O |
| InChI | InChI=1S/C11H11F3N4OS/c1-2-15-10-7(16-17-20-10)6-18-8(11(12,13)14)4-3-5-9(18)19/h3-5,15H,2,6H2,1H3 |
| InChIKey | UQQORGZIDORAOB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |