C11H14N4OS — CID 55159380
1-[[5-(ethylamino)thiadiazol-4-yl]methyl]-3-methylpyridin-2-one (PubChem CID 55159380) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is 1-[[5-(ethylamino)thiadiazol-4-yl]methyl]-3-methylpyridin-2-one.
| Compound Name | 1-[[5-(ethylamino)thiadiazol-4-yl]methyl]-3-methylpyridin-2-one |
|---|---|
| PubChem CID | 55159380 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 1-[[5-(ethylamino)thiadiazol-4-yl]methyl]-3-methylpyridin-2-one |
| SMILES | CCNc1snnc1Cn1cccc(C)c1=O |
| InChI | InChI=1S/C11H14N4OS/c1-3-12-10-9(13-14-17-10)7-15-6-4-5-8(2)11(15)16/h4-6,12H,3,7H2,1-2H3 |
| InChIKey | JGBMNCRAXKOIAP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |